Dabigatran Impurity F is a chemical compound used as a pharmaceutical impurity reference standard, specifically for quality control in the manufacturing of dabigatran-related products. It is an ester derivative featuring a benzimidazole core and a pyridine ring, characterized by moderate polarity and aromatic functionality.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1642853-67-5
N-Propylsulfamide sodium salt
chemical research reagent
4-Fluorobenzylmagnesium chloride
Grignard reagent for organic synthesis
Rac-(1R,2S)-2-(3-fluorophenyl)cyclopropan-1-amine hydrochloride
research compound
2-Bromo-4-(tert-butyl-d9)-pyridine
deuterated research compound
ethyl 3-[(1-methyl-2-oxo-3H-benzimidazole-5-carbonyl)-pyridin-2-ylamino]propanoate
XGBDRKLLXAESOC-UHFFFAOYSA-N
CCOC(=O)CCN(C1=CC=CC=N1)C(=O)C2=CC3=C(C=C2)N(C(=O)N3)C