N-DODECANE-D26 is a fully deuterated form of dodecane, where all 26 hydrogen atoms are replaced with deuterium. It is primarily used as an internal standard in analytical chemistry, particularly in nuclear magnetic resonance (NMR) spectroscopy and mass spectrometry, to improve accuracy in quantitative analysis.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 16416-30-1
N-tetracosane-d50
isotopically labeled research standard
(2H18)Octane
Deuterated NMR solvent and internal standard
N-decane-d22
deuterated alkane reference standard
N-HEXANE-D14
Deuterated solvent for analytical chemistry
2,2,6,6-d4-Morpholine
deuterated standard for analytical chemistry
Phenylacetic-d7 acid
deuterated standard for analytical chemistry
2-methylphenyl boronic acid
research compound
Methyl 5-bromo-1H-pyrrole-3-carboxylate
Research compound for chemical synthesis
1,1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-hexacosadeuteriododecane
SNRUBQQJIBEYMU-DWXHPOBZSA-N
[2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])[2H]