This compound is a protected uridine phosphoramidite derivative used as a building block in the solid-phase synthesis of oligonucleotides. Its structure incorporates a 2'-O-(2-methoxyethyl) modification, a 5'-O-dimethoxytrityl protecting group, and a 3'-O-(diisopropylamino-2-cyanoethoxyphosphanyl) group, making it suitable for automated RNA synthesis in research and pharmaceutical manufacturing.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 163759-97-5
Uridine, 5'-O-[bis(4-methoxyphenyl)phenylmethyl]-2'-O-propyl-, 3'-[2-cyanoethyl bis(1-methylethyl)phosphoramidite] (9CI)
RNA synthesis building block
Uridine, 5'-O-[bis(4-methoxyphenyl)phenylmethyl]-2'-O-methyl-, 3'-[2-cyanoethyl N,N-bis(1-methylethyl)phosphoramidite]
RNA synthesis phosphoramidite building block
2'-propargyl U amidite
RNA synthesis phosphoramidite building block
2'-O-Hexadecyl-U-CE-Phosphoramidite
nucleoside phosphoramidite for oligonucleotide synthesis
(R)-1-Boc-3-methylpiperazine
pharmaceutical intermediate
(S)-2,4,5-Trifluoro-N-(1,1,1-trifluoropropan-2-yl)benzamide
Pharmaceutical intermediate
2-Ethoxy-1,3-benzodioxole-5-carboxaldehyde
pharmaceutical intermediate
(S)-N-Benzyl-1-(1-naphthyl)ethylamine hydrochloride
pharmaceutical intermediate
3-[[(2R,3R,4R,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(2,4-dioxopyrimidin-1-yl)-4-(2-methoxyethoxy)oxolan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile
ZLOKLUONKGURQI-UAQIPLLRSA-N
CC(C)N(C(C)C)P(OCCC#N)O[C@@H]1[C@H](O[C@H]([C@@H]1OCCOC)N2C=CC(=O)NC2=O)COC(C3=CC=CC=C3)(C4=CC=C(C=C4)OC)C5=CC=C(C=C5)OC