EEDQ is a research reagent commonly used as a peptide coupling reagent in laboratory peptide synthesis. It facilitates the formation of amide bonds by activating carboxylic acids.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 16357-59-8
Benzotriazol-1-yloxy-tris(dimethylamino)phosphonium hexafluorophosphate
peptide coupling reagent
Propylphosphonic anhydride
peptide coupling reagent
2-Hbtu
peptide coupling reagent
2-(2,5-Dioxopyrrolidin-1-yl)-1,1,3,3-tetramethylisouronium tetrafluoroborate
peptide coupling reagent
(S)-1-(Thiophen-3-yl)ethanamine
research compound
Cyclo(-Ala-Glu)
research compound
Trans-Zeatin
Plant cytokinin research reagent
(2R,3R,4S,5R)-2-(6-aMino-2-(3,3,3-trifluoropropylthio)-9H-purin-9-yl)-5-(hydroxyMethyl)tetrahydrofuran-3,4-diol
research compound
ethyl 2-ethoxy-2H-quinoline-1-carboxylate
GKQLYSROISKDLL-UHFFFAOYSA-N
CCOC1C=CC2=CC=CC=C2N1C(=O)OCC