2-Iodo-4-(trifluoromethyl)aniline is an aromatic amine compound containing a trifluoromethyl group and an iodine atom on the benzene ring. It is primarily used as a building block or intermediate in chemical research and pharmaceutical manufacturing, particularly in the synthesis of more complex organic molecules.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 163444-17-5
2-iodo-4-(trifluoromethyl)aniline
UKKWTZPXYIYONW-UHFFFAOYSA-N
C1=CC(=C(C=C1C(F)(F)F)I)N
—