This compound is a research reagent utilized in organometallic chemistry, characterized by its aromatic ring structure and non-polar nature.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 16259-59-9
5-Bromo-2-thiopheneboronic Acid (contains varying amounts of Anhydride)
boronic acid cross-coupling reagent
5-Chlorothiophene-2-boronic acid
boronic acid reagent for synthesis
B-1-dibenzofuranylBoronic acid
Boronic acid for chemical synthesis
(5-methylthiophen-2-yl)boronic Acid
boronic acid research reagent
6,6-bis(p-methoxyphenyl)fulvene
organic synthesis research compound
6,6-Diphenylfulvene
research compound
1-[cyclopenta-2,4-dien-1-ylidene-(4-methylphenyl)methyl]-4-methylbenzene
QGNPNNCBCMUAAA-UHFFFAOYSA-N
CC1=CC=C(C=C1)C(=C2C=CC=C2)C3=CC=C(C=C3)C