3,5-Diacetamido-2,4-diiodobenzoic acid is an iodinated aromatic compound containing two amide groups and a carboxylic acid function. It is structurally related to amidotrizoic acid and is primarily encountered as a chemical intermediate or research compound.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 162193-52-4
3,5-diacetamido-2,4-diiodobenzoic acid
IUTSOSUQGPWYBZ-UHFFFAOYSA-N
CC(=O)NC1=C(C(=C(C(=C1)C(=O)O)I)NC(=O)C)I