Fmoc-Lys(Ac)-OH is a protected amino acid derivative used as a building block in solid-phase peptide synthesis. The Fmoc group protects the alpha-amino group, while the acetylated lysine side chain allows for selective incorporation of acetyllysine into peptide sequences.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 159766-56-0
(2S)-2,6-bis({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)hexanoic acid
Protected amino acid for peptide synthesis
(2S)-6-{[(benzyloxy)carbonyl]amino}-2-{[(9H-fluoren-9-ylmethoxy)carbonyl]amino}hexanoic acid
peptide synthesis protected amino acid
Z-Lys(Fmoc)-OH
Protected lysine derivative for peptide synthesis
(2S)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-6-{[(prop-2-en-1-yloxy)carbonyl]amino}hexanoic acid
Protected amino acid for peptide synthesis
FMOC-PHE(4-BR)-OH
Research compound for peptide synthesis
(2S)-2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)-3-(naphthalen-2-yl)propanoic acid
Research compound for peptide synthesis
Fmoc-N-methyl-L-alloisoleucine
Research compound for peptide synthesis
4-Methyl-L-phenylalanine
Research compound for peptide synthesis
(2S)-6-acetamido-2-(9H-fluoren-9-ylmethoxycarbonylamino)hexanoic acid
HQLBYVWJOXITAM-NRFANRHFSA-N
CC(=O)NCCCC[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13