This compound is a highly substituted octahydrocorrin derivative containing three nitrophenyl groups, characterized by a complex polycyclic structure with multiple stereocenters and a high molecular weight. Its structural features include multiple aromatic rings and heterocycles, and the presence of both donor and acceptor groups suggests potential electronic or optical properties.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1570275-52-3
8,14-dimethyl-5,10,15-tris(4-nitrophenyl)-1,2,7,8,13,21,22,23-octahydrocorrin
ZBGTYBGGNQXSDZ-UHFFFAOYSA-N
CC1CC2=C(C3=CCC(N3)C4=NC(=C(C5(CC=C(N5)C(=C1N2)C6=CC=C(C=C6)[N+](=O)[O-])C)C7=CC=C(C=C7)[N+](=O)[O-])C=C4)C8=CC=C(C=C8)[N+](=O)[O-]
—