Heptanoic-7,7,7-d3 acid is a deuterium-labeled analytical reference standard, specifically the This compound isotopologue. It is primarily used in research and laboratory settings as a stable isotope internal standard for quantitative analysis.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 156779-04-3
Heptadecanoic acid-d3
deuterated fatty acid reference standard
Tetradecanoic-14,14,14-d3 acid
isotopically labeled fatty acid standard
Decanoic-10,10,10-d3 acid
deuterated fatty acid research standard
Nonanoic acid-d3
deuterated fatty acid reference standard
Sodium borodeuteride
deuterated reducing agent
1,8-NAPHTHYRIDINE, 2-METHYL-
chemical research compound
4,4-dimethyl-2-oxotetrahydrofuran-3-yl methacrylate
research compound
(9H-Fluoren-9-yl)methyl 2-oxoethylcarbamate
Fmoc-protected aminoacetaldehyde reagent
7,7,7-trideuterioheptanoic acid
MNWFXJYAOYHMED-FIBGUPNXSA-N
[2H]C([2H])([2H])CCCCCC(=O)O