This compound is a pharmaceutical intermediate used in chemical manufacturing. It features a complex structure with multiple aromatic rings and amine groups.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 156732-13-7
2-fluorocyclopropane-1-carboxylic Acid
pharmaceutical intermediate
(S)-2-Bromo-1-(3-chloro-4-fluorophenyl)ethan-1-ol
Pharmaceutical intermediate
(3r,3as,6ar)-Hexahydrofuro[2,3-B]furan-3-Ol
Pharmaceutical intermediate
(S)-2-((ethoxycarbonyl)amino)-3,3-dimethylbutanoic acid
Pharmaceutical intermediate for peptide synthesis
(Z,2S)-5-amino-2-(dibenzylamino)-1,6-diphenylhex-4-en-3-one
IVYLNCUETJNNJU-AYRMWSDDSA-N
C1=CC=C(C=C1)C[C@@H](C(=O)/C=C(/CC2=CC=CC=C2)\N)N(CC3=CC=CC=C3)CC4=CC=CC=C4