Sodium methallylsulfonate is an industrial chemical primarily used as a surfactant intermediate. It serves as a key building block in the production of various surfactants and surface-active agents.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1561-92-8
TRIMETHYLOLPROPANE TRIACRYLATE
Crosslinking agent for coatings and adhesives
3-Methyl-3-buten-1-yl 2-methyl-2-propenoate
Methacrylate monomer for polymer synthesis
Sodium percarbonate
bleaching agent in laundry and cleaning products
2-Ethylhexyl diphenyl phosphite
Plastic additive
sodium 2-methylprop-2-ene-1-sulfonate
SZHIIIPPJJXYRY-UHFFFAOYSA-M
CC(=C)CS(=O)(=O)[O-].[Na+]