(S)-gamma-fluoroleucine ethyl ester is a chiral, fluorinated amino acid derivative used as a pharmaceutical intermediate in the manufacture of active pharmaceutical ingredients. Its structure features an amine, an ester, and a halogen, contributing to its role in chemical synthesis for drug development.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 156047-39-1
5-Bromo-3-methylpyridine-2-carbonitrile
Pharmaceutical intermediate
6-Bromo-4-methylpyridin-3-amine
Pharmaceutical intermediate for drug synthesis
ADL 08-0011
alvimopan metabolite
Ent-Alvimopan
Alvimopan impurity
ethyl (2S)-2-amino-4-fluoro-4-methylpentanoate
MJEBOMLXSMSDDI-LURJTMIESA-N
CCOC(=O)[C@H](CC(C)(C)F)N