[(2-Aminoethoxy)methyl]tributylstannane is an organotin compound used as a synthetic intermediate in research laboratories. Its structure features a stannane center with a 2-aminoethoxy methyl group, making it valuable for organotin chemistry and specialty synthesis.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1557288-04-6
1H-Indazol-5-ol
research compound
(5S)-5-Methyl-2-Pyrrolidinone
research compound
2-(3,4-Difluoro-2-methoxyphenyl)acetic acid
research compound
(3AS,4S,7R,7AS)-6-BENZYL-2,2-DIMETHYLTETRAHYDRO-4H-4,7-METHANO[1,3]DIOXOLO[4,5-D][1,2]OXAZINE
Reference standard for ticagrelor impurity
2-(tributylstannylmethoxy)ethanamine
YFZRXKFYLGAQOC-UHFFFAOYSA-N
CCCC[Sn](CCCC)(CCCC)COCCN