Diethylhexyl Butamido Triazone is a chemical compound used as a UV absorber in sunscreen formulations. It is characterized by a complex structure containing multiple aromatic rings and functional groups that contribute to its ultraviolet light absorption properties.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 154702-15-5
Ethylhexyl triazone
UVB sunscreen absorber
1-Benzylquinolinium chloride
Quaternary ammonium compound
Methyl 5-((2,4-difluorobenzyl)carbamoyl)-1-(2,2-dimethoxyethyl)-3-methoxy-4-oxo-1,4-dihydropyridine-2-carboxylate
research compound
Palmitoyl hexapeptide-12
cosmetic ingredient
Tetrabutylammonium hydrogencarbonate
phase transfer catalyst
2-ethylhexyl 4-[[4-[4-(tert-butylcarbamoyl)anilino]-6-[4-(2-ethylhexoxycarbonyl)anilino]-1,3,5-triazin-2-yl]amino]benzoate
OSCJHTSDLYVCQC-UHFFFAOYSA-N
CCCCC(CC)COC(=O)C1=CC=C(C=C1)NC2=NC(=NC(=N2)NC3=CC=C(C=C3)C(=O)NC(C)(C)C)NC4=CC=C(C=C4)C(=O)OCC(CC)CCCC