This compound is a pharmaceutical intermediate used in the synthesis of sulfonamide derivatives. It features a complex heterocyclic structure with multiple functional groups, including an alcohol and an aromatic ring, contributing to its polar and ring-containing character.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 154127-42-1
3-Acetyl-2-(aminosulfonyl)-5-chlorothiophene
Pharmaceutical intermediate for sulfonamide synthesis
2-chloropyridine-3-sulfonyl Chloride
Pharmaceutical intermediate for sulfonamide synthesis
Benzyl 4-(chlorosulfonyl)piperidine-1-carboxylate
Pharmaceutical intermediate for sulfonamide synthesis
Methyl 2-methoxy-5-sulfamoylbenzoate
Pharmaceutical intermediate for sulfonamide synthesis
3,5-Difluoro-4-iodoaniline
pharmaceutical intermediate
2-Isopropyl-4-(N-methyl)amino-methyl thiazole
Pharmaceutical intermediate
3-Keto-5alpha-abiraterone
Abiraterone acetate impurity standard
[(8R,9S,10R,13S,14S)-10,13-dimethyl-2,7,8,9,11,12,14,15-octahydro-1H-cyclopenta[a]phenanthren-17-yl] trifluoromethanesulfonate
abiraterone acetate intermediate
(4S)-4-hydroxy-2-(3-methoxypropyl)-1,1-dioxo-3,4-dihydrothieno[3,2-e]thiazine-6-sulfonamide
UHIWBQIWXWWDKT-MRVPVSSYSA-N
COCCCN1C[C@H](C2=C(S1(=O)=O)SC(=C2)S(=O)(=O)N)O