This compound is a pharmaceutical intermediate used in the production of the carbapenem antibiotic biapenem. It is a salt-like heterocyclic compound containing a thiol group and an aromatic ring system.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 153851-71-9
(S)-tert-Butyl (1-oxo-1-phenylhex-5-yn-2-yl)carbamate
Boc-protected pharmaceutical intermediate
5,6-Dihydro-4H-benzo[b]thieno[2,3-d]azepine-2-carboxylic acid
Pharmaceutical intermediate
1,2,3,5-TETRA-O-BENZOYL-2-C-METHYL-BETA-D-RIBOFURANOSE
Pharmaceutical intermediate
Boc-Pro-Pro-OH
peptide synthesis intermediate
6,7-dihydro-5H-pyrazolo[1,2-a][1,2,4]triazol-4-ium-6-thiol chloride
HPBXUFOSZBCEIQ-UHFFFAOYSA-N
C1C(C[N+]2=CN=CN21)S.[Cl-]