Trimethylacetic anhydride is a chemical compound used as a research reagent for organic synthesis. It functions as a derivatization agent in analytical chemistry and serves as a building block for introducing the trimethylacetyl group into target molecules.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1538-75-6
L-Glutamine, N2-((1,1-dimethylethoxy)carbonyl)-, 4-nitrophenyl ester
peptide synthesis intermediate
2-cyclopropyl-1,1-difluoro-3-methoxypropan-2-ol
research compound
2,2'-Dipicolylamine
research reagent for coordination chemistry
5-Fluoro-dl-tryptophan
non-proteinogenic amino acid research compound
2,2-dimethylpropanoyl 2,2-dimethylpropanoate
PGZVFRAEAAXREB-UHFFFAOYSA-N
CC(C)(C)C(=O)OC(=O)C(C)(C)C