(4-Isobutylphenyl)boronic acid is a boronic acid derivative featuring an aromatic ring substituted with an isobutyl group. It is commonly used as a research reagent in organic synthesis and medicinal chemistry.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 153624-38-5
Sec-Butylmagnesium chloride
Grignard reagent for organic synthesis
Creatine Ethyl Ester HCL
research compound
Methyl 1H-pyrazole-3-carboxylate
research compound
3-[2-[2-[2-[2-[[4-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-4-oxobutanoyl]amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid
research compound for click chemistry
[4-(2-methylpropyl)phenyl]boronic acid
YZSPHVWALUJQNK-UHFFFAOYSA-N
B(C1=CC=C(C=C1)CC(C)C)(O)O