This compound is an aluminum salt form of a nitrosoaniline derivative, commonly supplied as a research reagent. Its structure features an aromatic ring and an amine-like functional group, and it is typically used in laboratory settings for chemical synthesis or analytical studies.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 15305-07-4
كوبفيرون
analytical reagent for metal separation
(R)-Tetrahydro-2-furancarbothioic acid
research compound
Isoquinoline N-oxide
research compound
4-Bromoisoquinoline
research compound
1,4-Benzenediamine-d8
deuterated research compound
N-bis[(N-nitrosoanilino)oxy]alumanyloxy-N-phenylnitrous amide
PMSRCBOGDIMQAT-UHFFFAOYSA-N
C1=CC=C(C=C1)N(N=O)O[Al](ON(C2=CC=CC=C2)N=O)ON(C3=CC=CC=C3)N=O
—