Ginkgolide B is a naturally occurring diterpenoid lactone found in Ginkgo biloba, characterized by a complex polycyclic structure with multiple ether and ester groups. It is primarily recognized as a research compound for its role as a PAF-receptor antagonist.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 15291-77-7
Flavoxate
antispasmodic pharmaceutical ingredient
Diclofenac Ethyl Ester
active pharmaceutical ingredient
Diclofenac sodium
active pharmaceutical ingredient
Diclofenac potassium
active pharmaceutical ingredient
Ginkgolide A
research compound
Ginkgolide C
n.a
(1R,3R,6R,7S,8S,10R,11R,12S,13S,16S,17R)-8-tert-butyl-6,12,17-trihydroxy-16-methyl-2,4,14,19-tetraoxahexacyclo[8.7.2.01,11.03,7.07,11.013,17]nonadecane-5,15,18-trione
SQOJOAFXDQDRGF-ZMVGXLHTSA-N
C[C@@H]1C(=O)O[C@@H]2[C@]1([C@@]34C(=O)O[C@H]5[C@]3([C@@H]2O)[C@@]6([C@@H](C5)C(C)(C)C)[C@H](C(=O)O[C@H]6O4)O)O