4-Hydroxybenzoic-2,3,5,6-d4 acid is a deuterated form of 4-hydroxybenzoic acid where all four aromatic hydrogen atoms are replaced with deuterium. It is primarily used as an internal standard in analytical chemistry to improve the accuracy of quantitative measurements.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 152404-47-2
Acenaphthylene D8
deuterated internal standard for analytical chemistry
Triruthenium dodecacarbonyl
organometallic research reagent
5-Bromo-6-methoxy-1H-indazole
research compound
Bis-PEG6-NHS ester
bifunctional crosslinking reagent
5-bromo-2-methoxy-3-nitropyridine
research compound
Potassium 4-hydroxybenzoate
preservative in cosmetics and food
4-HYDROXYBENZOIC ACID
intermediate for food preservatives
2,3,5,6-tetradeuterio-4-hydroxybenzoic acid
FJKROLUGYXJWQN-RHQRLBAQSA-N
[2H]C1=C(C(=C(C(=C1C(=O)O)[2H])[2H])O)[2H]