Beta-Aminobenzenebutanoic acid is a pharmaceutical intermediate used in the synthesis of peptides and other active pharmaceutical ingredients. It features a beta-amino acid structure with an aromatic ring, contributing to its role as a building block in medicinal chemistry.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 15099-85-1
(2S)-2-amino-2-methyl-3-sulfanylpropanoic acid hydrochloride
alpha-methyl cysteine derivative for synthesis
4-(difluoromethoxy)-3-hydroxybenzaldehyde
Pharmaceutical intermediate
3-(cyclopropylmethoxy)-4-(difluoromethoxy)benzaldehyde
Roflumilast intermediate
4,5-Didehydro Brimonidine
pharmaceutical research intermediate
3-amino-4-phenylbutanoic acid
OFVBLKINTLPEGH-UHFFFAOYSA-N
C1=CC=C(C=C1)CC(CC(=O)O)N