L-N-Butylsulfonyl-p-hydroxyphenylalanine is a chemical compound with the formula C13H19NO5S. It functions as a pharmaceutical intermediate, primarily used in the synthesis of active pharmaceutical ingredients.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 149490-60-8
Propanedioic acid, 2-(4-bromophenyl)-, 1,3-dimethyl ester
pharmaceutical intermediate
4-(4-CYANOPHENYL)PIPERIDINE
Pharmaceutical intermediate
6-BROMO-5-(TRIFLUOROMETHYL)NICOTINONITRILE
Pharmaceutical intermediate
1-N-Boc-pyrrolidin-2-ylboronic acid
pharmaceutical intermediate synthesis
(2S)-2-(butylsulfonylamino)-3-(4-hydroxyphenyl)propanoic acid
VCKJOKXXEIQENI-LBPRGKRZSA-N
CCCCS(=O)(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)O