(E)-Fenpyroximate (free acid) is an agrochemical compound that serves as a metabolite of the acaricide fenpyroximate. It is characterized by a structure containing aromatic rings, an ether linkage, and a carboxylic acid group.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 149054-56-8
Fenpyroximate
Acaricide and insecticide
Butanoic acid, 2-amino-, (2S)-
herbicide precursor
Bifenazate
Selective miticide for mite control
Nitenpyram
crop pesticide
Calcium ammonium nitrate
Soil amendment fertilizer
4-[[(E)-(1,3-dimethyl-5-phenoxypyrazol-4-yl)methylideneamino]oxymethyl]benzoic acid
ZGSVZVKVXOZKSG-CIAFOILYSA-N
CC1=NN(C(=C1/C=N/OCC2=CC=C(C=C2)C(=O)O)OC3=CC=CC=C3)C