Bis(benzonitrile)dichloroplatinum is a platinum coordination compound used as a reagent in platinum chemistry research. It features a platinum center coordinated to two benzonitrile ligands and two chloride ions, making it a valuable laboratory chemical for synthetic and catalytic studies.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تبحث عن شراء Bis(benzonitrile)dichloroplatinum؟
انشر طلب شراء مجانًا — دون الحاجة إلى حساب. يصل الطلب إلى مورّدي هذا المنتج، وتصلك الردود مباشرة عبر بريدك الإلكتروني.
Phenyl cyanide
solvent and intermediate for chemical synthesis
Bis(benzonitrile)palladium chloride
coordination complex and catalyst precursor
Platinate(2-), tetrachloro-, disodium, (SP-4-1)-
platinum coordination chemistry reagent
2-Propenethioamide, 3-(3,5-bis(1,1-dimethylethyl)-4-hydroxyphenyl)-2-cyano-, (E)-
Protein tyrosine kinase inhibitor
1-Bromo-4-chloro-2-iodobenzene
Research reagent for organic synthesis
1,3-Dihydro-3-(3-iodopropyl)-7,8-dimethoxy-2H-3-benzazepin-2-one
research compound
Cyclopropanecarboxaldehyde
Research reagent
bis(benzonitrile);dichloroplatinum
WAJRCRIROYMRKA-UHFFFAOYSA-L
C1=CC=C(C=C1)C#N.C1=CC=C(C=C1)C#N.Cl[Pt]Cl
هل تبحث عن شراء Bis(benzonitrile)dichloroplatinum؟
انشر طلب شراء مجانًا — دون الحاجة إلى حساب. يصل الطلب إلى مورّدي هذا المنتج، وتصلك الردود مباشرة عبر بريدك الإلكتروني.