This compound is a chitosan oligosaccharide building block consisting of two linked glucosamine units. It is primarily used as a structural component for research and synthesis in carbohydrate chemistry.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 148411-57-8
CHITOSAN HYDROCHLORIDE
Glucosamine derivative for pharmaceutical synthesis
Tetraoctylammonium bromide
Phase transfer catalyst
N-Nitroso Clonidine
Nitrosamine impurity standard
Patulin
mycotoxin analytical reference standard
Glutacondianil hydrochloride
research reagent or chemical intermediate
Alpha-Lactose monohydrate
nutrient and excipient in food
Lactose
food ingredient and excipient
Xylan, hydrogen sulfate
anticoagulant sulfated polysaccharide
(2R,3S,4R,5R,6S)-5-amino-6-[(2R,3S,4R,5R,6R)-5-amino-4,6-dihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy-2-(hydroxymethyl)oxane-3,4-diol
QLTSDROPCWIKKY-PMCTYKHCSA-N
C([C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)O[C@@H]2[C@H](O[C@H]([C@@H]([C@H]2O)N)O)CO)N)O)O)O