This compound is a deuterated amine reference standard used in analytical and research applications. Its fully deuterated methyl groups make it valuable for mass spectrometry and nuclear magnetic resonance spectroscopy as an internal standard or tracer.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 14802-36-9
Di((2H3)methyl)ammonium chloride
deuterated analytical standard
Ethyl-d5-amine hydrochloride
deuterated amine reference standard
Dibenzocyclooctyne-PEG4 maleimide
Copper-free click chemistry reagent
2,4-Dichloro-6-phenyl-1,3,5-triazine-d5
deuterated research reagent
2-Chloro-4,4,5,5-tetramethyl-1,3,2-dioxaphospholane
Phosphorochloridite reagent
1-Benzylpiperidin-3-ol
research compound
Dimethylamine hydrochloride
Paint and industrial chemical intermediate
Dimethylamine-15N hydrochloride
isotopically labeled research reagent
1,1,1-trideuterio-N-(trideuteriomethyl)methanamine
ROSDSFDQCJNGOL-WFGJKAKNSA-N
[2H]C([2H])([2H])NC([2H])([2H])[2H]