Indole-2-carboxylic acid is an indolyl carboxylic acid used primarily as a research compound or assay reagent. Its structure features a carboxylic acid group attached to an indole ring, contributing to its utility in laboratory studies.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1477-50-5
Propionic-2,2-d2 acid-d
deuterated research reagent
Omega-conotoxin MVIIC
research compound
Copper(ii)hexafluor-2,4-pentanedionate
Coordination chemistry research reagent
Dichloro(1,10-phenanthroline)copper(II)
research compound
1H-indole-2-carboxylic acid
HCUARRIEZVDMPT-UHFFFAOYSA-N
C1=CC=C2C(=C1)C=C(N2)C(=O)O