DIDNTB is a highly brominated and iodinated phenolic compound used as a biochemical research reagent. Its structure features multiple halogen substituents and nitro groups, making it a specialized tool for laboratory studies.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 145551-16-2
(prop-1-en-2-yl)boronic acid
boronic acid reagent for synthesis
Ruthenium, dicarbonyldichlorobis(triphenylphosphine)-
catalyst for organic synthesis
1,1-Dimethylethyl N-[(3S,5S,6R)-6-methyl-2-oxo-5-phenyl-1-(2,2,2-trifluoroethyl)-3-piperidinyl]carbamate
Research reagent
Tert-Butyl ((3S,5S,6R)-6-methyl-2-oxo-5-(2,3,6-trifluorophenyl)piperidin-3-yl)carbamate
Research compound
Tetrabromophenol blue
pH indicator and dye
Bromothymol blue
pH indicator
أخضر البروموكريسول
pH indicator dye
أرجواني البروموكريسول
pH indicator dye
2-iodo-6-nitro-4-[4,5,6,7-tetrabromo-3-(4-hydroxy-3-iodo-5-nitrophenyl)-1,1-dioxo-2,1lambda6-benzoxathiol-3-yl]phenol
NMHYCKTXIQQVPE-UHFFFAOYSA-N
C1=C(C=C(C(=C1[N+](=O)[O-])O)I)C2(C3=C(C(=C(C(=C3Br)Br)Br)Br)S(=O)(=O)O2)C4=CC(=C(C(=C4)I)O)[N+](=O)[O-]