1-Boc-D-Pyroglutamic acid ethyl ester is a chemical compound used as a pharmaceutical intermediate. It features a protected amino acid derivative structure with a tert-butoxycarbonyl (Boc) group and an ethyl ester, commonly employed in the synthesis of peptide-based compounds.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 144978-35-8
1-tert-butyl 2-methyl (2R)-5-oxopyrrolidine-1,2-dicarboxylate
Pharmaceutical intermediate for peptide synthesis
(S)-3-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-4-methoxy-4-oxobutanoic acid
Protected amino acid for peptide synthesis
T-Butyl (3S)-3-fluoro-4-oxopiperidine-1-carboxylate
pharmaceutical intermediate
((1R,2S)-2-(3-fluorophenyl)-2-((tosyloxy)methyl)cyclopropyl)methyl acetate
pharmaceutical intermediate
2-bromo-1-(4-methylphenyl)propan-1-one
pharmaceutical intermediate
1-(1,1-Dimethylethyl) 2-ethyl (2S)-5-oxo-1,2-pyrrolidinedicarboxylate
Pharmaceutical intermediate for peptide synthesis
1-O-tert-butyl 2-O-ethyl (2R)-5-oxopyrrolidine-1,2-dicarboxylate
YWWWGFSJHCFVOW-MRVPVSSYSA-N
CCOC(=O)[C@H]1CCC(=O)N1C(=O)OC(C)(C)C