4-Nitrophenyl 1,3-thiazol-5-ylmethyl carbonate is a chemical compound used as a pharmaceutical intermediate. It features a carbonate ester linked to a nitrophenyl group and a thiazole ring, making it a building block for synthesizing more complex molecules.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 144163-97-3
1,3-Thiazol-5-ylmethyl N-[(1S,2S,4S)-4-amino-1-benzyl-2-hydroxy-5-phenylpentyl]carbamate
pharmaceutical intermediate for protease inhibitors
(S)-tert-butyl 6-(5-(7-broMo-9,9-difluoro-9H-fluoren-2-yl)-1H-iMidazol-2-yl)-5-azaspiro[2.4]heptane-5-carboxylate
Pharmaceutical intermediate for antiviral synthesis
Potassium (S)-5-(tert-butoxycarbonyl)-5-azaspiro[2.4]heptane-6-carboxylate
pharmaceutical intermediate
1-Boc-4-(aminomethyl)piperidine
Pharmaceutical intermediate for drug synthesis
(4-nitrophenyl) 1,3-thiazol-5-ylmethyl carbonate
FTEKBGGQRNJIPQ-UHFFFAOYSA-N
C1=CC(=CC=C1[N+](=O)[O-])OC(=O)OCC2=CN=CS2
—