Phenoxyacetic anhydride is a chemical compound used primarily as a research reagent. It consists of two phenoxyacetate groups linked by an anhydride bond, giving it a structure with aromatic rings and ether linkages.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 14316-61-1
3-Cyclopenten-1-one
Research reagent
5'-Deshydroxy 5'-Chloro L-Adenosine
research compound
N-(4-(5-Hydroxy-2,3,4,5-tetrahydro-1H-benzo[b]azepine-1-carbonyl)-3-methylphenyl)-2-methylbenzamide
research compound
(2H4)Urea
deuterated research reagent
(2-phenoxyacetyl) 2-phenoxyacetate
CCSBNBKMACZDGN-UHFFFAOYSA-N
C1=CC=C(C=C1)OCC(=O)OC(=O)COC2=CC=CC=C2