Copper(II) ethylacetoacetate is a copper coordination compound primarily used as a research reagent. It serves as a source of copper ions in synthetic and materials chemistry studies.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 14284-06-1
Rhodium(III) 2,4-pentanedionate
Research reagent and reference standard
Ruthenium(III) acetylacetonate
coordination chemistry research reagent
((5Alpha,6Alpha)-4,5-Epoxymorphinan-3,6-diol)
Certified reference standard
N4-Acetylcytidine triphosphate
Modified nucleotide triphosphate for research
copper bis(ethyl 3-oxobutanoate)
OXFZSJOUPRCPJO-UHFFFAOYSA-N
CCOC(=O)[CH-]C(=O)C.CCOC(=O)[CH-]C(=O)C.[Cu+2]