DBCO-PEG4-NHS ester is a research reagent used in click chemistry crosslinking, featuring a strained alkyne (DBCO) group that enables copper-free azide-alkyne cycloaddition. Its PEG4 spacer improves solubility and flexibility, while the NHS ester group allows selective conjugation to primary amines.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تبحث عن شراء DBCO-PEG4-NHS ester؟
انشر طلب شراء مجانًا — دون الحاجة إلى حساب. يصل الطلب إلى مورّدي هذا المنتج، وتصلك الردود مباشرة عبر بريدك الإلكتروني.
DBCO-CONH-S-S-NHS ester
click chemistry conjugation reagent
3-[2-[2-[2-[2-[[4-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-4-oxobutanoyl]amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid
research compound for click chemistry
Dbco-nhs ester
Copper-free click chemistry reagent
(7-(4-(4-(Benzo[b]thiophen-4-yl)piperazin-1-yl)butoxy)quinolin-2-yloxy)methyl cyclohexyl carbonate
research compound
(7-(4-(4-(Benzo[b]thiophen-4-yl)piperazin-1-yl)butoxy)-2-oxoquinolin-1(2h)-yl)methyl cyclohexyl carbonate hydrochloride
Research compound with piperazine linker
Methyl 5-chloropentanoate
research compound
Methyl 6-bromohexanoate
Organic synthesis building block
(2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[[4-(2-azatricyclo[10.4.0.04,9]hexadeca-1(16),4,6,8,12,14-hexaen-10-yn-2-yl)-4-oxobutanoyl]amino]ethoxy]ethoxy]ethoxy]ethoxy]propanoate
RRCXYKNJTKJNTD-UHFFFAOYSA-N
C1CC(=O)N(C1=O)OC(=O)CCOCCOCCOCCOCCNC(=O)CCC(=O)N2CC3=CC=CC=C3C#CC4=CC=CC=C42
هل تبحث عن شراء DBCO-PEG4-NHS ester؟
انشر طلب شراء مجانًا — دون الحاجة إلى حساب. يصل الطلب إلى مورّدي هذا المنتج، وتصلك الردود مباشرة عبر بريدك الإلكتروني.