3-(Trifluoromethyl)phenylboronic acid is a boronic acid derivative featuring an aromatic ring with a trifluoromethyl substituent. It is commonly employed as a research reagent in organic synthesis, particularly in cross-coupling reactions such as the Suzuki-Miyaura reaction, where it serves as a building block for constructing carbon-carbon bonds.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1423-26-3
2-Trifluoromethylphenylboronic acid
research compound
4-Ethynylaniline
Research intermediate for supramolecular chemistry
4-Bromo-1,1'-biphenyl-d9
research reagent
4-bromopyridin-1-ium-1-olate
research compound
[3-(trifluoromethyl)phenyl]boronic acid
WOAORAPRPVIATR-UHFFFAOYSA-N
B(C1=CC(=CC=C1)C(F)(F)F)(O)O