This compound is a purine nucleoside analogue with multiple benzyl ether protecting groups and a cyclopentane core. It is primarily used as an intermediate in the synthesis of pharmaceutical agents.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 142217-77-4
(1S,2S,3S,5S)-3-(benzyloxy)-5-(6-(benzyloxy)-2-(((4-methoxyphenyl)diphenylmethyl)amino)-9H-purin-9-yl)-2-((benzyloxy)methyl)cyclopentanol
entecavir intermediate
(3R,4S)-3-FLUOROOXAN-4-OL
Pharmaceutical intermediate for drug synthesis
Linaclotide Impurity 3(Acylated Linaclotide)
impurity reference standard for linaclotide
1-Boc-3-cyanoazetidine
Pharmaceutical intermediate for azetidine derivatives
(1S,2S,3S,5S)-5-(2-amino-6-phenylmethoxypurin-9-yl)-3-phenylmethoxy-2-(phenylmethoxymethyl)cyclopentan-1-ol
SYPCZZWUNIHLBU-COROXYKFSA-N
C1[C@@H]([C@H]([C@@H]([C@H]1OCC2=CC=CC=C2)COCC3=CC=CC=C3)O)N4C=NC5=C4N=C(N=C5OCC6=CC=CC=C6)N