This compound is a benzofuran derivative featuring a nitro group and a hydroxyphenyl ketone moiety. It is primarily used as a pharmaceutical intermediate in the synthesis of other chemical compounds.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 141645-16-1
(2-Butyl-5-nitrobenzofuran-3-yl)(4-methoxyphenyl)methanone
research compound
(5-Bromo-3-(trifluoromethyl)pyridin-2-yl)methanamine hydrochloride
pharmaceutical synthetic intermediate
3-[[(2R,3S,5R)-2-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-5-(6-oxo-1H-purin-9-yl)oxolan-3-yl]oxy-[di(propan-2-yl)amino]phosphanyl]oxypropanenitrile
DNA synthesis phosphoramidite building block
Tert-butyl 3-hydroxyazetidine-1-carboxylate
protected building block for synthesis
Tert-Butyl 3-((methylsulfonyl)oxy)pyrrolidine-1-carboxylate
Pharmaceutical intermediate
(2-Butyl-5-nitrobenzofuran-3-yl)(4-(3-dibutylaminopropoxy)phenyl)methanone
active pharmaceutical ingredient
(2-Butylbenzofuran-3-yl) (4-hydroxyphenyl) ketone
pharmaceutical intermediate
1-Methoxy Amiodarone
pharmaceutical impurity reference standard
(2-butyl-5-nitro-1-benzofuran-3-yl)-(4-hydroxyphenyl)methanone
ZJZKLBXEGZKOBW-UHFFFAOYSA-N
CCCCC1=C(C2=C(O1)C=CC(=C2)[N+](=O)[O-])C(=O)C3=CC=C(C=C3)O