1,4-difluoro-2-methyl-5-nitrobenzene is a fluorinated nitroaromatic compound used primarily as a pharmaceutical intermediate in the synthesis of active pharmaceutical ingredients.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 141412-60-4
(R)-Methyl 2-amino-3-(7-methyl-1H-indazol-5-yl)propanoate dihydrochloride
Pharmaceutical intermediate for active compounds
Tert-butyl 4-(((6-amino-5-(4-phenoxyphenyl)pyrimidin-4-yl)amino)methyl)piperidine-1-carboxylate
Pharmaceutical intermediate
2-Amino-4-bromo-3-fluorobenzoic acid
pharmaceutical intermediate
4-Nitro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol
Pharmaceutical intermediate synthesis
1,4-difluoro-2-methyl-5-nitrobenzene
ABWWQMGGJXKGBL-UHFFFAOYSA-N
CC1=CC(=C(C=C1F)[N+](=O)[O-])F