2-Bromo-4-iododibenzo[b,d]furan is a halogenated aromatic compound consisting of a dibenzofuran core substituted with bromine and iodine atoms. It is primarily used as a research reagent in chemical synthesis and laboratory studies.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1401068-25-4
2-bromo-4-iododibenzofuran
XFUQQJVGELKGMN-UHFFFAOYSA-N
C1=CC=C2C(=C1)C3=C(O2)C(=CC(=C3)Br)I