This compound is a deuterated analytical reference standard, specifically the nitric acid salt of a deuterated imidazole derivative. It is primarily used as a research reagent for analytical chemistry applications.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1398065-80-9
Imazalil-d5 Sulfate
deuterated analytical reference standard
Bis(2-butoxyethyl) Phthalate-d4
reference standard for phthalate analysis
2,4-DICHLOROBENZOIC-D3 ACID
deuterated research reference standard
(+/-)-Zopiclone-d3 (N-methyl-d3)
deuterated research standard
Miconazole nitrate
antifungal active pharmaceutical ingredient
ميكونازول
antifungal active pharmaceutical ingredient
Miconazole nitrate
antifungal active pharmaceutical ingredient
Econazole nitrate
active pharmaceutical ingredient
1-[2-(2,4-dichlorophenyl)-2-[dideuterio-(2,4-dichloro-3,5,6-trideuteriophenyl)methoxy]ethyl]imidazole;nitric acid
MCCACAIVAXEFAL-LVRIMRNISA-N
[2H]C1=C(C(=C(C(=C1C([2H])([2H])OC(CN2C=CN=C2)C3=C(C=C(C=C3)Cl)Cl)Cl)[2H])Cl)[2H].[N+](=O)(O)[O-]