tert-Butyl N-propylsulfamoylcarbamate is a chemical compound used as a pharmaceutical intermediate in the synthesis of active pharmaceutical ingredients. It features a sulfamoyl carbamate group and an ether moiety, contributing to its polar and moderately lipophilic properties.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1393813-40-5
N-[5-(4-Bromophenyl)-6-chloro-4-pyrimidinyl]-N'-propylsulfamide
pharmaceutical intermediate for drug synthesis
2-AMINOPYRAZOLO[1,5-A]PYRIMIDINE-3-CARBOXYLIC ACID
Pharmaceutical intermediate
Methyl 2-[[4-(2-cyanophenyl)phenyl]methylamino]-3-nitrobenzoate
pharmaceutical intermediate
Ethyl 1-((2'-cyano(1,1'-biphenyl)-4-yl)methyl)-2-ethoxy-1H-benzimidazole-7-carboxylate
pharmaceutical intermediate
tert-butyl N-(propylsulfamoyl)carbamate
DNKVAMMOETYAIM-UHFFFAOYSA-N
CCCNS(=O)(=O)NC(=O)OC(C)(C)C