Internalized-arginylglycylaspartic acid cyclic peptide is a research reagent used for laboratory studies. It is a cyclic peptide with a structure including multiple amide and amine groups, characterized by a polar, water-soluble nature.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 1392278-76-0
Certepetide
research compound
4-(Trifluoromethoxy)phenylboronic acid
research compound for organic synthesis
Tetraamminepalladium(II) chloride monohydrate
research compound for palladium chemistry
Azido-PEG2-PFP ester
bioconjugation crosslinking reagent
4,7,10,13,16-Pentaoxanonadec-18-ynoic acid, 2,5-dioxo-1-pyrrolidinyl ester
PEG-linked alkyne NHS ester crosslinker
(6S,9S,15S,18R,23R,26S,29S)-18-amino-6-(4-aminobutyl)-9,26-bis(carboxymethyl)-15-[3-(diaminomethylideneamino)propyl]-2,5,8,11,14,17,25,28-octaoxo-20,21-dithia-1,4,7,10,13,16,24,27-octazabicyclo[27.3.0]dotriacontane-23-carboxylic acid
YHTTWXCDIRTOQX-FQJIPJFPSA-N
C1C[C@H]2C(=O)N[C@H](C(=O)N[C@@H](CSSC[C@@H](C(=O)N[C@H](C(=O)NCC(=O)N[C@H](C(=O)N[C@H](C(=O)NCC(=O)N2C1)CCCCN)CC(=O)O)CCCN=C(N)N)N)C(=O)O)CC(=O)O