CL 316,243 is a research compound that acts on the beta-3 adrenergic receptor. It is a salt-form molecule containing multiple polar and aromatic functional groups, typically used in laboratory studies to investigate receptor pharmacology.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 138908-40-4
Dirhodium tetracaprolactamate
dirhodium catalyst for carbene reactions
(3R)-(+)-3-(Methylamino)pyrrolidine
research compound
4-Fluoro-3-(trifluoromethyl)phenyl isocyanate
chemical synthesis intermediate
N,N-Bis(2-(6-fluorochroman-2-yl)-2-hydroxyethyl)nitrous amide
Nitrosamine reference standard
disodium;5-[(2R)-2-[[(2R)-2-(3-chlorophenyl)-2-hydroxyethyl]amino]propyl]-1,3-benzodioxole-2,2-dicarboxylate
FUZBPOHHSBDTJQ-CFOQQKEYSA-L
C[C@H](CC1=CC2=C(C=C1)OC(O2)(C(=O)[O-])C(=O)[O-])NC[C@@H](C3=CC(=CC=C3)Cl)O.[Na+].[Na+]