(3-Phenoxyphenyl)methanol is a chemical compound primarily known as a metabolite formed during the hydrolysis of certain pyrethroid insecticides, such as permethrin, by enzymes like pyrethroid hydrolase. It features an alcohol group, two aromatic rings, and an ether linkage, contributing to its moderate lipophilicity and polar surface area.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 13826-35-2
3-Phenoxybenzoic acid
pyrethroid insecticide metabolite
إيميداكلوبريد
systemic insecticide for crop protection
1-[(difluoromethyl)sulfonyl]-3-(4,6-dimethoxy-1,3,5-triazin-2-yl)-7-fluoro-1H-indol-2-ol
Agrochemical intermediate or active ingredient
2,4-DICHLOROTOLUENE-3,5,6-D3
Deuterated agrochemical reference standard
Quizalofop-ethyl D3 (3,3,3-D3)
Herbicide active ingredient
(3-phenoxyphenyl)methanol
KGANAERDZBAECK-UHFFFAOYSA-N
C1=CC=C(C=C1)OC2=CC=CC(=C2)CO