Tert-butyl 4-formylpiperidine-1-carboxylate is a chemical compound featuring a piperidine ring with a formyl group and a tert-butyl carbamate protecting group. It is primarily used as an intermediate in the synthesis of pharmaceutical compounds.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 137076-22-3
2-(((1-(tert-Butoxy)-2-methyl-1-oxopropan-2-yl)oxy)imino)-2-(2-((tert-butoxycarbonyl)amino)thiazol-4-yl)acetic acid
pharmaceutical intermediate
6-Chloro-2-methylpyridine-3-carboxylic acid
pharmaceutical intermediate
Voriconazole camphor sulfonate
Pharmaceutical intermediate for voriconazole
4-Chloro-6-ethyl-5-fluoropyrimidine
pharmaceutical intermediate
tert-butyl 4-formylpiperidine-1-carboxylate
JYUQEWCJWDGCRX-UHFFFAOYSA-N
CC(C)(C)OC(=O)N1CCC(CC1)C=O