3-Phenylisoserine, (2R,3S)- is a stereochemically defined amino acid derivative featuring an aromatic ring, a hydroxyl group, and an amine group. It is primarily encountered as a research compound and building block in chemical synthesis.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 136561-53-0
(2R,3S)-3-amino-2-hydroxy-3-phenylpropanoic acid
RZARFIRJROUVLM-JGVFFNPUSA-N
C1=CC=C(C=C1)[C@@H]([C@H](C(=O)O)O)N