4-Pyridinecarboxylic acid 1-oxide is an N-oxide derivative of isonicotinic acid, featuring a carboxylic acid group attached to a pyridine ring at the 4-position. It is structurally related to picolinic acid and nicotinic acid, which have the carboxyl group at the 2- and 3-positions, respectively.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 13602-12-5
Triphenylmethylium tetrakis(perfluorophenyl)borate
Research reagent for hydride abstraction
3'-O-(Azidomethyl)-2'-deoxythymidine
Research compound
5-bromo-3-(trifluoromethyl)pyrazin-2-amine
research compound
4-BROMO-1-BUTANOL-1,1,2,2,3,3,4,4-D8
deuterated research compound
1-oxidopyridin-1-ium-4-carboxylic acid
QCWTWMJMLSKQCJ-UHFFFAOYSA-N
C1=C[N+](=CC=C1C(=O)O)[O-]