This compound is a boronic acid derivative featuring a pyrrole ring protected by a tert-butoxycarbonyl (Boc) group. It is primarily used as a pharmaceutical intermediate in the synthesis of complex organic molecules for research and manufacturing.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 135884-31-0
5-chloro-2-hydroxybenzonitrile
pharmaceutical intermediate
3-(tert-Butyl)-6-(ethylthio)-1,3,5-triazine-2,4(1H,3H)-dione
Pharmaceutical intermediate synthesis
Methyl 6-methylpyridine-2-carboxylate
Pharmaceutical intermediate for synthesis
(1R,2S)-(+)-cis-1-Amino-2-indanol
Pharmaceutical intermediate for chiral synthesis
[1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrol-2-yl]boronic acid
ZWGMJLNXIVRFRJ-UHFFFAOYSA-N
B(C1=CC=CN1C(=O)OC(C)(C)C)(O)O