This compound is a protected amino acid intermediate used in peptide synthesis. It features a benzyloxycarbonyl (Cbz) protecting group on the nitrogen of 4-hydroxy-L-proline, making it a key building block for the production of modified peptides and pharmaceutical intermediates.
نطاق المحتوى: تتعلق المعلومات الواردة في هذه الصفحة بتحديد المواد الكيميائية وبسياقات التوريد الصناعي والبحث والإنتاج. وهي لا تشكّل ادعاءً علاجياً أو نصيحة طبية أو إرشادات لاستخدام الأدوية.
هل تشتري أو تورد هذا المركب؟
أضف مخزونك أو أنشر طلب شراء
CAS 13504-85-3
Dibenzyl (2S,4R)-4-hydroxypyrrolidine-1,2-dicarboxylate
protected proline derivative for peptide synthesis
N-Cbz-cis-4-Hydroxy-L-proline methyl ester
protected proline derivative for peptide synthesis
2-Methyl 1-(phenylmethyl) (2S,4R)-4-hydroxy-1,2-pyrrolidinedicarboxylate
Peptide synthesis building block
Boc-O-methyl-L-tyrosine
Protected amino acid intermediate
(2S)-2-{[(tert-butoxy)carbonyl](methyl)amino}-4-methylpentanoic acid
Protected amino acid intermediate
2-{[(tert-butoxy)carbonyl]amino}-2-(3-chlorophenyl)acetic acid
Protected amino acid intermediate
N-(tert-Butoxycarbonyl)-L-cyclohexylglycine
Protected amino acid intermediate
N-Boc-cis-4-Hydroxy-D-proline
Pharmaceutical intermediate for peptide synthesis
(2S,4R)-4-hydroxy-1-phenylmethoxycarbonylpyrrolidine-2-carboxylic acid
WWVCWLBEARZMAH-MNOVXSKESA-N
C1[C@H](CN([C@@H]1C(=O)O)C(=O)OCC2=CC=CC=C2)O